C24H15ClO3 — CID 25148063
7-(4-chlorophenyl)-9-methyl-3-phenylfuro[3,2-g]chromen-5-one (PubChem CID 25148063) has the molecular formula C24H15ClO3 and a molecular weight of 386.83 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-9-methyl-3-phenylfuro[3,2-g]chromen-5-one.
| Compound Name | 7-(4-chlorophenyl)-9-methyl-3-phenylfuro[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 25148063 |
| Molecular Formula | C24H15ClO3 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 7-(4-chlorophenyl)-9-methyl-3-phenylfuro[3,2-g]chromen-5-one |
| SMILES | Cc1c2occ(-c3ccccc3)c2cc2c(=O)cc(-c3ccc(Cl)cc3)oc12 |
| InChI | InChI=1S/C24H15ClO3/c1-14-23-18(20(13-27-23)15-5-3-2-4-6-15)11-19-21(26)12-22(28-24(14)19)16-7-9-17(25)10-8-16/h2-13H,1H3 |
| InChIKey | BJLCZBBKPHJPIZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |