About 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione
6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione (PubChem CID 5018451) has the molecular formula C16H7Br2ClO3
and a molecular weight of 442.49 g/mol. Its IUPAC name is 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione.
Molecular Properties
| Compound Name | 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione |
| PubChem CID | 5018451 |
| Molecular Formula | C16H7Br2ClO3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 439.85 |
| IUPAC Name | 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione |
| SMILES | O=c1cc(-c2ccc(Cl)cc2)oc2c(=O)c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C16H7Br2ClO3/c17-9-5-11-13(20)7-14(8-1-3-10(19)4-2-8)22-16(11)15(21)12(18)6-9/h1-7H |
| InChIKey | RKWDELBOAQSMAV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione?
The IUPAC name of 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione (CID 5018451) is 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione.
What is the SMILES notation for 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione?
The canonical SMILES for 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione is O=c1cc(-c2ccc(Cl)cc2)oc2c(=O)c(Br)cc(Br)cc12.
What is the InChIKey of 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione?
The InChIKey is RKWDELBOAQSMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H7Br2ClO3/c17-9-5-11-13(20)7-14(8-1-3-10(19)4-2-8)22-16(11)15(21)12(18)6-9/h1-7H.
What are the key properties of 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione?
6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione has a molecular weight of 442.49 g/mol, XLogP of 5.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione is sourced from PubChem (CID 5018451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).