C16H7Br2ClO3 — CID 5018451
6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione (PubChem CID 5018451) has the molecular formula C16H7Br2ClO3 and a molecular weight of 442.49 g/mol. Its IUPAC name is 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione.
| Compound Name | 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione |
|---|---|
| PubChem CID | 5018451 |
| Molecular Formula | C16H7Br2ClO3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 439.85 |
| IUPAC Name | 6,8-dibromo-2-(4-chlorophenyl)cyclohepta[b]pyran-4,9-dione |
| SMILES | O=c1cc(-c2ccc(Cl)cc2)oc2c(=O)c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C16H7Br2ClO3/c17-9-5-11-13(20)7-14(8-1-3-10(19)4-2-8)22-16(11)15(21)12(18)6-9/h1-7H |
| InChIKey | RKWDELBOAQSMAV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |