C18H14O3 — CID 25148235
3-methyl-7-phenyl-6,7-dihydrofuro[3,2-g]chromen-5-one (PubChem CID 25148235) has the molecular formula C18H14O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-methyl-7-phenyl-6,7-dihydrofuro[3,2-g]chromen-5-one.
| Compound Name | 3-methyl-7-phenyl-6,7-dihydrofuro[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 25148235 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-methyl-7-phenyl-6,7-dihydrofuro[3,2-g]chromen-5-one |
| SMILES | Cc1coc2cc3c(cc12)C(=O)CC(c1ccccc1)O3 |
| InChI | InChI=1S/C18H14O3/c1-11-10-20-17-9-18-14(7-13(11)17)15(19)8-16(21-18)12-5-3-2-4-6-12/h2-7,9-10,16H,8H2,1H3 |
| InChIKey | UEEWUSPNEJYBKH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |