About ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate
ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate (PubChem CID 25148271) has the molecular formula C19H20N2O4
and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate |
| PubChem CID | 25148271 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1CCn2c(C(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C19H20N2O4/c1-2-25-17(22)12-20-19(24)14-10-11-21-15(14)8-9-16(21)18(23)13-6-4-3-5-7-13/h3-9,14H,2,10-12H2,1H3,(H,20,24) |
| InChIKey | QJXWNFWCXJBUEI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate?
The IUPAC name of ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate (CID 25148271) is ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate.
What is the SMILES notation for ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate?
The canonical SMILES for ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate is CCOC(=O)CNC(=O)C1CCn2c(C(=O)c3ccccc3)ccc21.
What is the InChIKey of ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate?
The InChIKey is QJXWNFWCXJBUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4/c1-2-25-17(22)12-20-19(24)14-10-11-21-15(14)8-9-16(21)18(23)13-6-4-3-5-7-13/h3-9,14H,2,10-12H2,1H3,(H,20,24).
What are the key properties of ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate?
ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate has a molecular weight of 340.38 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carbonyl)amino]acetate is sourced from PubChem (CID 25148271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).