C23H23N3O2 — CID 46861285
5-benzoyl-N-[4-(dimethylamino)phenyl]-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 46861285) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 5-benzoyl-N-[4-(dimethylamino)phenyl]-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | 5-benzoyl-N-[4-(dimethylamino)phenyl]-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 46861285 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 5-benzoyl-N-[4-(dimethylamino)phenyl]-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CCn3c(C(=O)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C23H23N3O2/c1-25(2)18-10-8-17(9-11-18)24-23(28)19-14-15-26-20(19)12-13-21(26)22(27)16-6-4-3-5-7-16/h3-13,19H,14-15H2,1-2H3,(H,24,28) |
| InChIKey | FFPAXTRQUWKDTJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|