C17H18N2O2 — CID 20708721
5-benzoyl-N,N-dimethyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 20708721) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-benzoyl-N,N-dimethyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | 5-benzoyl-N,N-dimethyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 20708721 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5-benzoyl-N,N-dimethyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | CN(C)C(=O)C1CCn2c(C(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C17H18N2O2/c1-18(2)17(21)13-10-11-19-14(13)8-9-15(19)16(20)12-6-4-3-5-7-12/h3-9,13H,10-11H2,1-2H3 |
| InChIKey | LEWXFECERIISHS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |