About 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium
5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium (PubChem CID 42609603) has the molecular formula C19H24N2O6
and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium.
Molecular Properties
| Compound Name | 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium |
| PubChem CID | 42609603 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium |
| SMILES | O=C(c1ccccc1)c1ccc2n1CCC2C(=O)[O-].OCC[NH+](CO)CO |
| InChI | InChI=1S/C15H13NO3.C4H11NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13;6-2-1-5(3-7)4-8/h1-7,11H,8-9H2,(H,18,19);6-8H,1-4H2 |
| InChIKey | YQIAQXODNKISMV-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium?
The IUPAC name of 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium (CID 42609603) is 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium.
What is the SMILES notation for 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium?
The canonical SMILES for 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium is O=C(c1ccccc1)c1ccc2n1CCC2C(=O)[O-].OCC[NH+](CO)CO.
What is the InChIKey of 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium?
The InChIKey is YQIAQXODNKISMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3.C4H11NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13;6-2-1-5(3-7)4-8/h1-7,11H,8-9H2,(H,18,19);6-8H,1-4H2.
What are the key properties of 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium?
5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium has a molecular weight of 376.41 g/mol, XLogP of -2.28, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate;2-hydroxyethyl-bis(hydroxymethyl)azanium is sourced from PubChem (CID 42609603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).