C21H23NO8 — CID 44815857
[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 44815857) has the molecular formula C21H23NO8 and a molecular weight of 417.41 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 44815857 |
| Molecular Formula | C21H23NO8 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc2n1CCC2C(=O)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H23NO8/c23-16(11-4-2-1-3-5-11)14-7-6-13-12(8-9-22(13)14)20(27)29-10-15-17(24)18(25)19(26)21(28)30-15/h1-7,12,15,17-19,21,24-26,28H,8-10H2/t12?,15-,17+,18+,19-,21?/m1/s1 |
| InChIKey | HXAXVRZRGDBUHC-MUOWRIJJSA-N |
| XLogP | -0.45 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |