About 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate
6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 10453594) has the molecular formula C21H24N2O6
and a molecular weight of 400.43 g/mol. Its IUPAC name is 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
Molecular Properties
| Compound Name | 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| PubChem CID | 10453594 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | O=C(c1ccccc1)c1ccc2n1CCC2C(=O)OCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O6/c24-20(16-8-4-3-5-9-16)19-11-10-18-17(12-13-22(18)19)21(25)28-14-6-1-2-7-15-29-23(26)27/h3-5,8-11,17H,1-2,6-7,12-15H2 |
| InChIKey | KRFWHCBIUKYSDG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The IUPAC name of 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate (CID 10453594) is 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
What is the SMILES notation for 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The canonical SMILES for 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate is O=C(c1ccccc1)c1ccc2n1CCC2C(=O)OCCCCCCO[N+](=O)[O-].
What is the InChIKey of 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The InChIKey is KRFWHCBIUKYSDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O6/c24-20(16-8-4-3-5-9-16)19-11-10-18-17(12-13-22(18)19)21(25)28-14-6-1-2-7-15-29-23(26)27/h3-5,8-11,17H,1-2,6-7,12-15H2.
What are the key properties of 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate has a molecular weight of 400.43 g/mol, XLogP of 3.52, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitrooxyhexyl 5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate is sourced from PubChem (CID 10453594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).