C20H24N2O5 — CID 89017477
4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 89017477) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 89017477 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | C=C(c1ccccc1)c1ccc2n1CCC2C(=O)OCCCCON(O)O |
| InChI | InChI=1S/C20H24N2O5/c1-15(16-7-3-2-4-8-16)18-9-10-19-17(11-12-21(18)19)20(23)26-13-5-6-14-27-22(24)25/h2-4,7-10,17,24-25H,1,5-6,11-14H2 |
| InChIKey | RLYBILJIUWXIPD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|