About 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate
4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 89017477) has the molecular formula C20H24N2O5
and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
Molecular Properties
| Compound Name | 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| PubChem CID | 89017477 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | C=C(c1ccccc1)c1ccc2n1CCC2C(=O)OCCCCON(O)O |
| InChI | InChI=1S/C20H24N2O5/c1-15(16-7-3-2-4-8-16)18-9-10-19-17(11-12-21(18)19)20(23)26-13-5-6-14-27-22(24)25/h2-4,7-10,17,24-25H,1,5-6,11-14H2 |
| InChIKey | RLYBILJIUWXIPD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The IUPAC name of 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (CID 89017477) is 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
What is the SMILES notation for 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The canonical SMILES for 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate is C=C(c1ccccc1)c1ccc2n1CCC2C(=O)OCCCCON(O)O.
What is the InChIKey of 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
The InChIKey is RLYBILJIUWXIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O5/c1-15(16-7-3-2-4-8-16)18-9-10-19-17(11-12-21(18)19)20(23)26-13-5-6-14-27-22(24)25/h2-4,7-10,17,24-25H,1,5-6,11-14H2.
What are the key properties of 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate?
4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate has a molecular weight of 372.42 g/mol, XLogP of 3.37, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dihydroxyamino)oxybutyl 5-(1-phenylethenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate is sourced from PubChem (CID 89017477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).