C24H34N2O3 — CID 149251772
octyl 5-(1-propylpyrrole-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 149251772) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is octyl 5-(1-propylpyrrole-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | octyl 5-(1-propylpyrrole-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 149251772 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | octyl 5-(1-propylpyrrole-2-carbonyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CCn2c(C(=O)c3cccn3CCC)ccc21 |
| InChI | InChI=1S/C24H34N2O3/c1-3-5-6-7-8-9-18-29-24(28)19-14-17-26-20(19)12-13-22(26)23(27)21-11-10-16-25(21)15-4-2/h10-13,16,19H,3-9,14-15,17-18H2,1-2H3 |
| InChIKey | PVSGYRSHEKJTRE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|