C20H21Cl2NO3 — CID 20528165
pentyl 6-chloro-5-(4-chlorobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 20528165) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is pentyl 6-chloro-5-(4-chlorobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | pentyl 6-chloro-5-(4-chlorobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 20528165 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | pentyl 6-chloro-5-(4-chlorobenzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | CCCCCOC(=O)C1CCn2c1cc(Cl)c2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2NO3/c1-2-3-4-11-26-20(25)15-9-10-23-17(15)12-16(22)18(23)19(24)13-5-7-14(21)8-6-13/h5-8,12,15H,2-4,9-11H2,1H3 |
| InChIKey | YWRWFYNUPUJCNM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|