C20H14N6O3 — CID 25149175
4-amino-10-(4-nitrophenyl)-2,5,7,9-tetrazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13,15,17-heptaen-12-one (PubChem CID 25149175) has the molecular formula C20H14N6O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is 4-amino-10-(4-nitrophenyl)-2,5,7,9-tetrazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13,15,17-heptaen-12-one.
| Compound Name | 4-amino-10-(4-nitrophenyl)-2,5,7,9-tetrazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13,15,17-heptaen-12-one |
|---|---|
| PubChem CID | 25149175 |
| Molecular Formula | C20H14N6O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 4-amino-10-(4-nitrophenyl)-2,5,7,9-tetrazatetracyclo[9.7.0.03,8.013,18]octadeca-1,3,5,7,13,15,17-heptaen-12-one |
| SMILES | Nc1ncnc2c1N=C1c3ccccc3C(=O)C1C(c1ccc([N+](=O)[O-])cc1)N2 |
| InChI | InChI=1S/C20H14N6O3/c21-19-17-20(23-9-22-19)25-15(10-5-7-11(8-6-10)26(28)29)14-16(24-17)12-3-1-2-4-13(12)18(14)27/h1-9,14-15H,(H3,21,22,23,25) |
| InChIKey | XLTPZFGWSCKHKG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|