C25H27F3N4O3 — CID 25153401
7-[4-[4-[6-(trifluoromethyl)-1,2-benzoxazol-3-yl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 25153401) has the molecular formula C25H27F3N4O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is 7-[4-[4-[6-(trifluoromethyl)-1,2-benzoxazol-3-yl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-[6-(trifluoromethyl)-1,2-benzoxazol-3-yl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 25153401 |
| Molecular Formula | C25H27F3N4O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 7-[4-[4-[6-(trifluoromethyl)-1,2-benzoxazol-3-yl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4noc5cc(C(F)(F)F)ccc45)CC3)cc2N1 |
| InChI | InChI=1S/C25H27F3N4O3/c26-25(27,28)18-5-7-20-22(15-18)35-30-24(20)32-12-10-31(11-13-32)9-1-2-14-34-19-6-3-17-4-8-23(33)29-21(17)16-19/h3,5-7,15-16H,1-2,4,8-14H2,(H,29,33) |
| InChIKey | JYSQUVVYGGXQPK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|