C25H29N3O5 — CID 140634232
7-[4-[4-(4,5-dihydroxy-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 140634232) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 7-[4-[4-(4,5-dihydroxy-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-(4,5-dihydroxy-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 140634232 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 7-[4-[4-(4,5-dihydroxy-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCN3CCC(c4noc5ccc(O)c(O)c45)CC3)cc2N1 |
| InChI | InChI=1S/C25H29N3O5/c29-20-6-7-21-23(25(20)31)24(27-33-21)17-9-12-28(13-10-17)11-1-2-14-32-18-5-3-16-4-8-22(30)26-19(16)15-18/h3,5-7,15,17,29,31H,1-2,4,8-14H2,(H,26,30) |
| InChIKey | VEASWEUVQQRXOB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|