C36H38N4O6S — CID 25154280
[1-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1-(pyridin-2-ylmethyl)indol-2-yl]-2-methylpropan-2-yl] 3-(nitrooxymethyl)benzoate (PubChem CID 25154280) has the molecular formula C36H38N4O6S and a molecular weight of 654.79 g/mol. Its IUPAC name is [1-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1-(pyridin-2-ylmethyl)indol-2-yl]-2-methylpropan-2-yl] 3-(nitrooxymethyl)benzoate.
| Compound Name | [1-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1-(pyridin-2-ylmethyl)indol-2-yl]-2-methylpropan-2-yl] 3-(nitrooxymethyl)benzoate |
|---|---|
| PubChem CID | 25154280 |
| Molecular Formula | C36H38N4O6S |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | [1-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1-(pyridin-2-ylmethyl)indol-2-yl]-2-methylpropan-2-yl] 3-(nitrooxymethyl)benzoate |
| SMILES | CC(C)(Cc1c(SC(C)(C)C)c2cc(OCc3ccccn3)ccc2n1Cc1ccccn1)OC(=O)c1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H38N4O6S/c1-35(2,3)47-33-30-20-29(44-24-28-14-7-9-18-38-28)15-16-31(30)39(22-27-13-6-8-17-37-27)32(33)21-36(4,5)46-34(41)26-12-10-11-25(19-26)23-45-40(42)43/h6-20H,21-24H2,1-5H3 |
| InChIKey | GLZFYVZUVLHBDW-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 118.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|