C31H42ClN3O4S — CID 25154388
4-[[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropanoyl]amino]butyl nitrate (PubChem CID 25154388) has the molecular formula C31H42ClN3O4S and a molecular weight of 588.21 g/mol. Its IUPAC name is 4-[[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropanoyl]amino]butyl nitrate.
| Compound Name | 4-[[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropanoyl]amino]butyl nitrate |
|---|---|
| PubChem CID | 25154388 |
| Molecular Formula | C31H42ClN3O4S |
| Molecular Weight | 588.21 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 4-[[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropanoyl]amino]butyl nitrate |
| SMILES | CC(C)c1ccc2c(c1)c(SC(C)(C)C)c(CC(C)(C)C(=O)NCCCCO[N+](=O)[O-])n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H42ClN3O4S/c1-21(2)23-12-15-26-25(18-23)28(40-30(3,4)5)27(34(26)20-22-10-13-24(32)14-11-22)19-31(6,7)29(36)33-16-8-9-17-39-35(37)38/h10-15,18,21H,8-9,16-17,19-20H2,1-7H3,(H,33,36) |
| InChIKey | AVKQWNMETJWQTN-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.21 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|