C25H31ClN2OS2 — CID 71168227
[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-2-(2-hydroxy-2-methylpropyl)indol-5-yl] N-methylmethanimidothioate (PubChem CID 71168227) has the molecular formula C25H31ClN2OS2 and a molecular weight of 475.12 g/mol. Its IUPAC name is [3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-2-(2-hydroxy-2-methylpropyl)indol-5-yl] N-methylmethanimidothioate.
| Compound Name | [3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-2-(2-hydroxy-2-methylpropyl)indol-5-yl] N-methylmethanimidothioate |
|---|---|
| PubChem CID | 71168227 |
| Molecular Formula | C25H31ClN2OS2 |
| Molecular Weight | 475.12 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-2-(2-hydroxy-2-methylpropyl)indol-5-yl] N-methylmethanimidothioate |
| SMILES | C/N=C/Sc1ccc2c(c1)c(SC(C)(C)C)c(CC(C)(C)O)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31ClN2OS2/c1-24(2,3)31-23-20-13-19(30-16-27-6)11-12-21(20)28(22(23)14-25(4,5)29)15-17-7-9-18(26)10-8-17/h7-13,16,29H,14-15H2,1-6H3/b27-16+ |
| InChIKey | RZKYSBVLKVUMKZ-JVWAILMASA-N |
| XLogP | 7.30 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.12 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|