C29H37ClN2O3S — CID 11756733
2-[(E)-[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropylidene]amino]oxyacetic acid (PubChem CID 11756733) has the molecular formula C29H37ClN2O3S and a molecular weight of 529.15 g/mol. Its IUPAC name is 2-[(E)-[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 11756733 |
| Molecular Formula | C29H37ClN2O3S |
| Molecular Weight | 529.15 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 2-[(E)-[3-[3-tert-butylsulfanyl-1-[(4-chlorophenyl)methyl]-5-propan-2-ylindol-2-yl]-2,2-dimethylpropylidene]amino]oxyacetic acid |
| SMILES | CC(C)c1ccc2c(c1)c(SC(C)(C)C)c(CC(C)(C)/C=N/OCC(=O)O)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H37ClN2O3S/c1-19(2)21-10-13-24-23(14-21)27(36-28(3,4)5)25(15-29(6,7)18-31-35-17-26(33)34)32(24)16-20-8-11-22(30)12-9-20/h8-14,18-19H,15-17H2,1-7H3,(H,33,34)/b31-18+ |
| InChIKey | YMFWUDCVNFMAQW-FDAWAROLSA-N |
| XLogP | 8.01 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.15 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|