C28H38N2O3S2 — CID 25155280
N'-tert-butyl-N-(butyldisulfanyl)-N'-(3,5-dimethylbenzoyl)-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide (PubChem CID 25155280) has the molecular formula C28H38N2O3S2 and a molecular weight of 514.76 g/mol. Its IUPAC name is N'-tert-butyl-N-(butyldisulfanyl)-N'-(3,5-dimethylbenzoyl)-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide.
| Compound Name | N'-tert-butyl-N-(butyldisulfanyl)-N'-(3,5-dimethylbenzoyl)-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide |
|---|---|
| PubChem CID | 25155280 |
| Molecular Formula | C28H38N2O3S2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N'-tert-butyl-N-(butyldisulfanyl)-N'-(3,5-dimethylbenzoyl)-2,7-dimethyl-2,3-dihydro-1-benzofuran-6-carbohydrazide |
| SMILES | CCCCSSN(C(=O)c1ccc2c(c1C)OC(C)C2)N(C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C28H38N2O3S2/c1-9-10-13-34-35-30(27(32)24-12-11-22-17-20(4)33-25(22)21(24)5)29(28(6,7)8)26(31)23-15-18(2)14-19(3)16-23/h11-12,14-16,20H,9-10,13,17H2,1-8H3 |
| InChIKey | LMQLUCPCICWIKC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|