C28H31ClN2O4S — CID 24971173
N-tert-butyl-N'-(4-chlorophenoxy)sulfanyl-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide (PubChem CID 24971173) has the molecular formula C28H31ClN2O4S and a molecular weight of 527.09 g/mol. Its IUPAC name is N-tert-butyl-N'-(4-chlorophenoxy)sulfanyl-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide.
| Compound Name | N-tert-butyl-N'-(4-chlorophenoxy)sulfanyl-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 24971173 |
| Molecular Formula | C28H31ClN2O4S |
| Molecular Weight | 527.09 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | N-tert-butyl-N'-(4-chlorophenoxy)sulfanyl-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide |
| SMILES | COc1cccc(C(=O)N(N(SOc2ccc(Cl)cc2)C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1C |
| InChI | InChI=1S/C28H31ClN2O4S/c1-18-15-19(2)17-21(16-18)26(32)31(36-35-23-13-11-22(29)12-14-23)30(28(4,5)6)27(33)24-9-8-10-25(34-7)20(24)3/h8-17H,1-7H3 |
| InChIKey | YJKFIGTUSRLLQJ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.09 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|