C31H35ClN2O5 — CID 70214688
[chloro-(4-methylphenyl)methyl] N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(3-methoxy-2-methylbenzoyl)amino]carbamate (PubChem CID 70214688) has the molecular formula C31H35ClN2O5 and a molecular weight of 551.08 g/mol. Its IUPAC name is [chloro-(4-methylphenyl)methyl] N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(3-methoxy-2-methylbenzoyl)amino]carbamate.
| Compound Name | [chloro-(4-methylphenyl)methyl] N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(3-methoxy-2-methylbenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 70214688 |
| Molecular Formula | C31H35ClN2O5 |
| Molecular Weight | 551.08 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [chloro-(4-methylphenyl)methyl] N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(3-methoxy-2-methylbenzoyl)amino]carbamate |
| SMILES | COc1cccc(C(=O)N(C(=O)c2cc(C)cc(C)c2)N(C(=O)OC(Cl)c2ccc(C)cc2)C(C)(C)C)c1C |
| InChI | InChI=1S/C31H35ClN2O5/c1-19-12-14-23(15-13-19)27(32)39-30(37)34(31(5,6)7)33(28(35)24-17-20(2)16-21(3)18-24)29(36)25-10-9-11-26(38-8)22(25)4/h9-18,27H,1-8H3 |
| InChIKey | SFKWNGOAKXARMG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.08 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|