C37H44N2O11 — CID 70218331
benzyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-[2-(2-methoxyethoxy)acetyl]oxyacetate (PubChem CID 70218331) has the molecular formula C37H44N2O11 and a molecular weight of 692.76 g/mol. Its IUPAC name is benzyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-[2-(2-methoxyethoxy)acetyl]oxyacetate.
| Compound Name | benzyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-[2-(2-methoxyethoxy)acetyl]oxyacetate |
|---|---|
| PubChem CID | 70218331 |
| Molecular Formula | C37H44N2O11 |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | benzyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-2-[2-(2-methoxyethoxy)acetyl]oxyacetate |
| SMILES | COCCOCC(=O)OC(OC(=O)N(C(=O)c1cccc(OC)c1C)N(C(=O)c1cc(C)cc(C)c1)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H44N2O11/c1-24-19-25(2)21-28(20-24)32(41)39(37(4,5)6)38(33(42)29-15-12-16-30(46-8)26(29)3)36(44)50-35(49-31(40)23-47-18-17-45-7)34(43)48-22-27-13-10-9-11-14-27/h9-16,19-21,35H,17-18,22-23H2,1-8H3 |
| InChIKey | KHGGZGZUUJMBAR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|