C37H44N2O7 — CID 101132704
[[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-phenylmethyl] (E)-hept-3-enoate (PubChem CID 101132704) has the molecular formula C37H44N2O7 and a molecular weight of 628.77 g/mol. Its IUPAC name is [[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-phenylmethyl] (E)-hept-3-enoate.
| Compound Name | [[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-phenylmethyl] (E)-hept-3-enoate |
|---|---|
| PubChem CID | 101132704 |
| Molecular Formula | C37H44N2O7 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | [[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-phenylmethyl] (E)-hept-3-enoate |
| SMILES | CCC/C=C/CC(=O)OC(OC(=O)N(C(=O)c1cccc(OC)c1C)N(C(=O)c1cc(C)cc(C)c1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C37H44N2O7/c1-9-10-11-15-21-32(40)45-35(28-17-13-12-14-18-28)46-36(43)38(34(42)30-19-16-20-31(44-8)27(30)4)39(37(5,6)7)33(41)29-23-25(2)22-26(3)24-29/h11-20,22-24,35H,9-10,21H2,1-8H3/b15-11+ |
| InChIKey | VPXMIKKYRFXDST-RVDMUPIBSA-N |
| XLogP | 8.04 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|