C33H38N2O7 — CID 12033239
[[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-(4-methylphenyl)methyl] acetate (PubChem CID 12033239) has the molecular formula C33H38N2O7 and a molecular weight of 574.67 g/mol. Its IUPAC name is [[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-(4-methylphenyl)methyl] acetate.
| Compound Name | [[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-(4-methylphenyl)methyl] acetate |
|---|---|
| PubChem CID | 12033239 |
| Molecular Formula | C33H38N2O7 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | [[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(3-methoxy-2-methylbenzoyl)carbamoyl]oxy-(4-methylphenyl)methyl] acetate |
| SMILES | COc1cccc(C(=O)N(C(=O)OC(OC(C)=O)c2ccc(C)cc2)N(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1C |
| InChI | InChI=1S/C33H38N2O7/c1-20-13-15-25(16-14-20)31(41-24(5)36)42-32(39)34(30(38)27-11-10-12-28(40-9)23(27)4)35(33(6,7)8)29(37)26-18-21(2)17-22(3)19-26/h10-19,31H,1-9H3 |
| InChIKey | YMPJDTASIHHTOX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|