C28H30Cl2N2O3S — CID 24971023
N'-tert-butyl-N-(2,4-dichlorophenoxy)sulfanyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide (PubChem CID 24971023) has the molecular formula C28H30Cl2N2O3S and a molecular weight of 545.53 g/mol. Its IUPAC name is N'-tert-butyl-N-(2,4-dichlorophenoxy)sulfanyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide.
| Compound Name | N'-tert-butyl-N-(2,4-dichlorophenoxy)sulfanyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 24971023 |
| Molecular Formula | C28H30Cl2N2O3S |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | N'-tert-butyl-N-(2,4-dichlorophenoxy)sulfanyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide |
| SMILES | CCc1ccc(C(=O)N(N(SOc2ccc(Cl)cc2Cl)C(=O)c2cc(C)cc(C)c2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H30Cl2N2O3S/c1-7-20-8-10-21(11-9-20)26(33)31(28(4,5)6)32(27(34)22-15-18(2)14-19(3)16-22)36-35-25-13-12-23(29)17-24(25)30/h8-17H,7H2,1-6H3 |
| InChIKey | JVXDWTXWFYLWAV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|