C35H40N2O7 — CID 11456184
butyl 3-[2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]-2-oxoacetyl]oxybenzoate (PubChem CID 11456184) has the molecular formula C35H40N2O7 and a molecular weight of 600.71 g/mol. Its IUPAC name is butyl 3-[2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]-2-oxoacetyl]oxybenzoate.
| Compound Name | butyl 3-[2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]-2-oxoacetyl]oxybenzoate |
|---|---|
| PubChem CID | 11456184 |
| Molecular Formula | C35H40N2O7 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | butyl 3-[2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]-2-oxoacetyl]oxybenzoate |
| SMILES | CCCCOC(=O)c1cccc(OC(=O)C(=O)N(C(=O)c2ccc(CC)cc2)N(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C35H40N2O7/c1-8-10-18-43-33(41)27-12-11-13-29(22-27)44-34(42)32(40)36(30(38)26-16-14-25(9-2)15-17-26)37(35(5,6)7)31(39)28-20-23(3)19-24(4)21-28/h11-17,19-22H,8-10,18H2,1-7H3 |
| InChIKey | UIDJASHYWBNDSI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|