C24H29IN2O4 — CID 70212681
iodomethyl N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(4-ethylbenzoyl)amino]carbamate (PubChem CID 70212681) has the molecular formula C24H29IN2O4 and a molecular weight of 536.41 g/mol. Its IUPAC name is iodomethyl N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(4-ethylbenzoyl)amino]carbamate.
| Compound Name | iodomethyl N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(4-ethylbenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 70212681 |
| Molecular Formula | C24H29IN2O4 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | iodomethyl N-tert-butyl-N-[(3,5-dimethylbenzoyl)-(4-ethylbenzoyl)amino]carbamate |
| SMILES | CCc1ccc(C(=O)N(C(=O)c2cc(C)cc(C)c2)N(C(=O)OCI)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29IN2O4/c1-7-18-8-10-19(11-9-18)21(28)26(27(24(4,5)6)23(30)31-15-25)22(29)20-13-16(2)12-17(3)14-20/h8-14H,7,15H2,1-6H3 |
| InChIKey | NTNKLWJIQISHRW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|