C44H51ClN4O5 — CID 89310943
N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide;N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide;furan (PubChem CID 89310943) has the molecular formula C44H51ClN4O5 and a molecular weight of 751.37 g/mol. Its IUPAC name is N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide;N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide;furan.
| Compound Name | N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide;N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide;furan |
|---|---|
| PubChem CID | 89310943 |
| Molecular Formula | C44H51ClN4O5 |
| Molecular Weight | 751.37 g/mol |
| Exact Mass | 750.35 |
| IUPAC Name | N'-benzoyl-N'-tert-butyl-4-chlorobenzohydrazide;N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide;furan |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Cl)cc1)C(=O)c1ccccc1.CCc1ccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)cc1.c1ccoc1 |
| InChI | InChI=1S/C22H28N2O2.C18H19ClN2O2.C4H4O/c1-7-17-8-10-18(11-9-17)20(25)23-24(22(4,5)6)21(26)19-13-15(2)12-16(3)14-19;1-18(2,3)21(17(23)14-7-5-4-6-8-14)20-16(22)13-9-11-15(19)12-10-13;1-2-4-5-3-1/h8-14H,7H2,1-6H3,(H,23,25);4-12H,1-3H3,(H,20,22);1-4H |
| InChIKey | XXYBMPLTLOFHEL-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.37 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|