C26H34N2O4 — CID 10646692
ethyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]acetate (PubChem CID 10646692) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is ethyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]acetate.
| Compound Name | ethyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 10646692 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | ethyl 2-[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1ccc(CC)cc1)N(C(=O)c1cc(C)cc(C)c1)C(C)(C)C |
| InChI | InChI=1S/C26H34N2O4/c1-8-20-10-12-21(13-11-20)24(30)27(17-23(29)32-9-2)28(26(5,6)7)25(31)22-15-18(3)14-19(4)16-22/h10-16H,8-9,17H2,1-7H3 |
| InChIKey | CHQYAUUVVMZHSI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|