C33H33Cl2N3O4 — CID 70215448
[[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]methyl 3,7-dichloroquinoline-8-carboxylate (PubChem CID 70215448) has the molecular formula C33H33Cl2N3O4 and a molecular weight of 606.55 g/mol. Its IUPAC name is [[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]methyl 3,7-dichloroquinoline-8-carboxylate.
| Compound Name | [[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]methyl 3,7-dichloroquinoline-8-carboxylate |
|---|---|
| PubChem CID | 70215448 |
| Molecular Formula | C33H33Cl2N3O4 |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | [[tert-butyl-(3,5-dimethylbenzoyl)amino]-(4-ethylbenzoyl)amino]methyl 3,7-dichloroquinoline-8-carboxylate |
| SMILES | CCc1ccc(C(=O)N(COC(=O)c2c(Cl)ccc3cc(Cl)cnc23)N(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H33Cl2N3O4/c1-7-22-8-10-23(11-9-22)30(39)37(38(33(4,5)6)31(40)25-15-20(2)14-21(3)16-25)19-42-32(41)28-27(35)13-12-24-17-26(34)18-36-29(24)28/h8-18H,7,19H2,1-6H3 |
| InChIKey | GVZHWTVUCZUFII-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|