C26H22N4O4 — CID 25155692
[4-[(2-hydroxy-5-pyridin-3-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate (PubChem CID 25155692) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is [4-[(2-hydroxy-5-pyridin-3-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | [4-[(2-hydroxy-5-pyridin-3-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 25155692 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [4-[(2-hydroxy-5-pyridin-3-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate |
| SMILES | O=C(NCc1cccnc1)OCc1ccc(C(=O)Nc2cc(-c3cccnc3)ccc2O)cc1 |
| InChI | InChI=1S/C26H22N4O4/c31-24-10-9-21(22-4-2-12-28-16-22)13-23(24)30-25(32)20-7-5-18(6-8-20)17-34-26(33)29-15-19-3-1-11-27-14-19/h1-14,16,31H,15,17H2,(H,29,33)(H,30,32) |
| InChIKey | URKJJPBXOCEGIE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|