C23H28N8 — CID 25156851
1-(3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)-3-N-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 25156851) has the molecular formula C23H28N8 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-(3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)-3-N-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)-3-N-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 25156851 |
| Molecular Formula | C23H28N8 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-(3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)-3-N-[4-(1-methylpiperidin-4-yl)phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | CN1CCC(c2ccc(Nc3nc(N)n(-c4ncc5c(n4)C4CCC5C4)n3)cc2)CC1 |
| InChI | InChI=1S/C23H28N8/c1-30-10-8-15(9-11-30)14-4-6-18(7-5-14)26-22-28-21(24)31(29-22)23-25-13-19-16-2-3-17(12-16)20(19)27-23/h4-7,13,15-17H,2-3,8-12H2,1H3,(H3,24,26,28,29) |
| InChIKey | KIWBCKVLLXYAHP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |