C22H28N8 — CID 25106487
1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-3-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 25106487) has the molecular formula C22H28N8 and a molecular weight of 404.52 g/mol. Its IUPAC name is 1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-3-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-3-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 25106487 |
| Molecular Formula | C22H28N8 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-3-N-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | CN1CCc2ccc(Nc3nc(N)n(-c4ncc5c(n4)CCCCCC5)n3)cc2C1 |
| InChI | InChI=1S/C22H28N8/c1-29-11-10-15-8-9-18(12-17(15)14-29)25-21-27-20(23)30(28-21)22-24-13-16-6-4-2-3-5-7-19(16)26-22/h8-9,12-13H,2-7,10-11,14H2,1H3,(H3,23,25,27,28) |
| InChIKey | VDINXFBUAISMPC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |