C27H36FN9O — CID 66846448
3-N-[3-fluoro-4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-1,2,4-triazole-3,5-diamine (PubChem CID 66846448) has the molecular formula C27H36FN9O and a molecular weight of 521.65 g/mol. Its IUPAC name is 3-N-[3-fluoro-4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-fluoro-4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 66846448 |
| Molecular Formula | C27H36FN9O |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 3-N-[3-fluoro-4-(4-morpholin-4-ylpiperidin-1-yl)phenyl]-1-(5,6,7,8,9,10-hexahydrocycloocta[d]pyrimidin-2-yl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCOCC4)CC3)c(F)c2)nn1-c1ncc2c(n1)CCCCCC2 |
| InChI | InChI=1S/C27H36FN9O/c28-22-17-20(7-8-24(22)36-11-9-21(10-12-36)35-13-15-38-16-14-35)31-26-33-25(29)37(34-26)27-30-18-19-5-3-1-2-4-6-23(19)32-27/h7-8,17-18,21H,1-6,9-16H2,(H3,29,31,33,34) |
| InChIKey | SGFHMXVWGVNXNN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|