C32H36FN9O — CID 67104418
3-N-[3-fluoro-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1-spiro[chromeno[4,3-c]pyridazine-5,1'-cyclopentane]-3-yl-1,2,4-triazole-3,5-diamine (PubChem CID 67104418) has the molecular formula C32H36FN9O and a molecular weight of 581.70 g/mol. Its IUPAC name is 3-N-[3-fluoro-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1-spiro[chromeno[4,3-c]pyridazine-5,1'-cyclopentane]-3-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-fluoro-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1-spiro[chromeno[4,3-c]pyridazine-5,1'-cyclopentane]-3-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 67104418 |
| Molecular Formula | C32H36FN9O |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | 3-N-[3-fluoro-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1-spiro[chromeno[4,3-c]pyridazine-5,1'-cyclopentane]-3-yl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(N3CCC(N4CCCC4)CC3)c(F)c2)nn1-c1cc2c(nn1)-c1ccccc1OC21CCCC1 |
| InChI | InChI=1S/C32H36FN9O/c33-25-19-21(9-10-26(25)41-17-11-22(12-18-41)40-15-5-6-16-40)35-31-36-30(34)42(39-31)28-20-24-29(38-37-28)23-7-1-2-8-27(23)43-32(24)13-3-4-14-32/h1-2,7-10,19-20,22H,3-6,11-18H2,(H3,34,35,36,39) |
| InChIKey | IHYWAUYWBKJYEL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|