C31H37N9 — CID 67104245
1-(5,6-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-3-N-[3-methyl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 67104245) has the molecular formula C31H37N9 and a molecular weight of 535.70 g/mol. Its IUPAC name is 1-(5,6-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-3-N-[3-methyl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(5,6-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-3-N-[3-methyl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 67104245 |
| Molecular Formula | C31H37N9 |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | 1-(5,6-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-3-N-[3-methyl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1cc(Nc2nc(N)n(-c3cc4c(nn3)CCCc3ccccc3-4)n2)ccc1N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C31H37N9/c1-21-19-23(11-12-28(21)39-17-13-24(14-18-39)38-15-4-5-16-38)33-31-34-30(32)40(37-31)29-20-26-25-9-3-2-7-22(25)8-6-10-27(26)35-36-29/h2-3,7,9,11-12,19-20,24H,4-6,8,10,13-18H2,1H3,(H3,32,33,34,37) |
| InChIKey | SIEZORJWGSONCR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|