C26H40O3 — CID 25159228
5,5-dimethyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione (PubChem CID 25159228) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 25159228 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 5,5-dimethyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C26H40O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(27)25-23(28)20-26(2,3)21-24(25)29/h5-6,8-9,11-12,25H,4,7,10,13-21H2,1-3H3/b6-5-,9-8-,12-11- |
| InChIKey | KMGLBVXCPYOJRK-AGRJPVHOSA-N |
| XLogP | 6.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|