C34H50N2O6 — CID 25161331
[(2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-pyrrolidine-2-carbonyl]amino]methyl]phenoxy]acetate (PubChem CID 25161331) has the molecular formula C34H50N2O6 and a molecular weight of 582.78 g/mol. Its IUPAC name is [(2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-pyrrolidine-2-carbonyl]amino]methyl]phenoxy]acetate.
| Compound Name | [(2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-pyrrolidine-2-carbonyl]amino]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 25161331 |
| Molecular Formula | C34H50N2O6 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | [(2R,3S,4R,6R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[3-[[[(2R)-pyrrolidine-2-carbonyl]amino]methyl]phenoxy]acetate |
| SMILES | CC[C@]1(C)C[C@@H](OC(=O)COc2cccc(CNC(=O)[C@H]3CCCN3)c2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C34H50N2O6/c1-6-32(4)18-27(33(5)21(2)12-14-34(22(3)30(32)39)15-13-26(37)29(33)34)42-28(38)20-41-24-10-7-9-23(17-24)19-36-31(40)25-11-8-16-35-25/h7,9-10,17,21-22,25,27,29-30,35,39H,6,8,11-16,18-20H2,1-5H3,(H,36,40)/t21?,22-,25+,27+,29?,30-,32+,33-,34?/m0/s1 |
| InChIKey | WZQUGWUGYZUFHF-NPCRDZMVSA-N |
| XLogP | 4.56 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |