C17H18F3N3O3S — CID 25162001
N,7a-dimethyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 25162001) has the molecular formula C17H18F3N3O3S and a molecular weight of 401.41 g/mol. Its IUPAC name is N,7a-dimethyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N,7a-dimethyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 25162001 |
| Molecular Formula | C17H18F3N3O3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N,7a-dimethyl-5-oxo-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)C1CSC2(C)CCC(=O)N12 |
| InChI | InChI=1S/C17H18F3N3O3S/c1-17-6-5-13(25)23(17)11(8-27-17)16(26)22(2)7-12(24)21-10-4-3-9(18)14(19)15(10)20/h3-4,11H,5-8H2,1-2H3,(H,21,24) |
| InChIKey | HCLZYRPSBXRMPU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|