C18H14Cl2N4O5 — CID 25164837
2-[1-[2-[(2,6-dichloro-4-pyridinyl)amino]-2-oxoethyl]-6-methyl-2,4-dioxoquinazolin-3-yl]acetic acid (PubChem CID 25164837) has the molecular formula C18H14Cl2N4O5 and a molecular weight of 437.24 g/mol. Its IUPAC name is 2-[1-[2-[(2,6-dichloro-4-pyridinyl)amino]-2-oxoethyl]-6-methyl-2,4-dioxoquinazolin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-[(2,6-dichloro-4-pyridinyl)amino]-2-oxoethyl]-6-methyl-2,4-dioxoquinazolin-3-yl]acetic acid |
|---|---|
| PubChem CID | 25164837 |
| Molecular Formula | C18H14Cl2N4O5 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-[1-[2-[(2,6-dichloro-4-pyridinyl)amino]-2-oxoethyl]-6-methyl-2,4-dioxoquinazolin-3-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)c(=O)n(CC(=O)O)c(=O)n2CC(=O)Nc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N4O5/c1-9-2-3-12-11(4-9)17(28)24(8-16(26)27)18(29)23(12)7-15(25)21-10-5-13(19)22-14(20)6-10/h2-6H,7-8H2,1H3,(H,26,27)(H,21,22,25) |
| InChIKey | NTDINEQMBFAZIF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|