C33H35FN2O5 — CID 25165122
(3R,5R)-7-[2-(4-fluorophenyl)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-phenyl-4-(phenylcarbamoyl)pyrrol-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 25165122) has the molecular formula C33H35FN2O5 and a molecular weight of 565.69 g/mol. Its IUPAC name is (3R,5R)-7-[2-(4-fluorophenyl)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-phenyl-4-(phenylcarbamoyl)pyrrol-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[2-(4-fluorophenyl)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-phenyl-4-(phenylcarbamoyl)pyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 25165122 |
| Molecular Formula | C33H35FN2O5 |
| Molecular Weight | 565.69 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | (3R,5R)-7-[2-(4-fluorophenyl)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-phenyl-4-(phenylcarbamoyl)pyrrol-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | [2H]C([2H])([2H])C([2H])(c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C33H35FN2O5/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40)/t26-,27-/m1/s1/i1D3,2D3,21D |
| InChIKey | XUKUURHRXDUEBC-XXJGTEOHSA-N |
| XLogP | 6.31 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |