C22H33N3O6 — CID 25165633
4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]ethyl-pentanoylamino]methyl]benzoic acid (PubChem CID 25165633) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]ethyl-pentanoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]ethyl-pentanoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 25165633 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-[[2-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]ethyl-pentanoylamino]methyl]benzoic acid |
| SMILES | CCCCC(=O)N(CCNC(=O)C(CC(C)C)C(=O)NO)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H33N3O6/c1-4-5-6-19(26)25(14-16-7-9-17(10-8-16)22(29)30)12-11-23-20(27)18(13-15(2)3)21(28)24-31/h7-10,15,18,31H,4-6,11-14H2,1-3H3,(H,23,27)(H,24,28)(H,29,30) |
| InChIKey | RNVMNMYZGKALJH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|