C25H31N3O6 — CID 87165951
4-[[2-[2-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]ethyl]pentanoylamino]methyl]benzoic acid (PubChem CID 87165951) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-[[2-[2-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]ethyl]pentanoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[2-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]ethyl]pentanoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 87165951 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-[[2-[2-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]ethyl]pentanoylamino]methyl]benzoic acid |
| SMILES | CCCC(CCNC(=O)C(Cc1ccccc1)C(=O)NO)C(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H31N3O6/c1-2-6-19(22(29)27-16-18-9-11-20(12-10-18)25(32)33)13-14-26-23(30)21(24(31)28-34)15-17-7-4-3-5-8-17/h3-5,7-12,19,21,34H,2,6,13-16H2,1H3,(H,26,30)(H,27,29)(H,28,31)(H,32,33) |
| InChIKey | GLPZANICZSCIQL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|