C17H25N3O4 — CID 13242802
2-benzyl-N-hydroxy-N'-[2-(3-methylbutylamino)-2-oxoethyl]propanediamide (PubChem CID 13242802) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-benzyl-N-hydroxy-N'-[2-(3-methylbutylamino)-2-oxoethyl]propanediamide.
| Compound Name | 2-benzyl-N-hydroxy-N'-[2-(3-methylbutylamino)-2-oxoethyl]propanediamide |
|---|---|
| PubChem CID | 13242802 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-benzyl-N-hydroxy-N'-[2-(3-methylbutylamino)-2-oxoethyl]propanediamide |
| SMILES | CC(C)CCNC(=O)CNC(=O)C(Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C17H25N3O4/c1-12(2)8-9-18-15(21)11-19-16(22)14(17(23)20-24)10-13-6-4-3-5-7-13/h3-7,12,14,24H,8-11H2,1-2H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | ZXDSFFOCXPBPSS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|