C18H30N2O3 — CID 25166469
2-[2-(3-butoxyphenyl)ethylamino]-3-methoxy-N,N-dimethylpropanamide (PubChem CID 25166469) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[2-(3-butoxyphenyl)ethylamino]-3-methoxy-N,N-dimethylpropanamide.
| Compound Name | 2-[2-(3-butoxyphenyl)ethylamino]-3-methoxy-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 25166469 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2-[2-(3-butoxyphenyl)ethylamino]-3-methoxy-N,N-dimethylpropanamide |
| SMILES | CCCCOc1cccc(CCNC(COC)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-6-12-23-16-9-7-8-15(13-16)10-11-19-17(14-22-4)18(21)20(2)3/h7-9,13,17,19H,5-6,10-12,14H2,1-4H3 |
| InChIKey | GNZSOXBPRNHNGO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|