C17H25F3N2O2 — CID 25166880
2-[2-[3-butoxy-4-(trifluoromethyl)phenyl]ethylamino]-N,N-dimethylacetamide (PubChem CID 25166880) has the molecular formula C17H25F3N2O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[2-[3-butoxy-4-(trifluoromethyl)phenyl]ethylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[2-[3-butoxy-4-(trifluoromethyl)phenyl]ethylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 25166880 |
| Molecular Formula | C17H25F3N2O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[2-[3-butoxy-4-(trifluoromethyl)phenyl]ethylamino]-N,N-dimethylacetamide |
| SMILES | CCCCOc1cc(CCNCC(=O)N(C)C)ccc1C(F)(F)F |
| InChI | InChI=1S/C17H25F3N2O2/c1-4-5-10-24-15-11-13(6-7-14(15)17(18,19)20)8-9-21-12-16(23)22(2)3/h6-7,11,21H,4-5,8-10,12H2,1-3H3 |
| InChIKey | YWKKIXDXGQJWAC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|