C21H25F3N6O4 — CID 25167712
N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]acetamide (PubChem CID 25167712) has the molecular formula C21H25F3N6O4 and a molecular weight of 482.46 g/mol. Its IUPAC name is N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]acetamide.
| Compound Name | N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 25167712 |
| Molecular Formula | C21H25F3N6O4 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H25F3N6O4/c1-13(31)28-16-8-6-14(7-9-16)10-25-19-17(30(32)33)12-27-20(29-19)26-11-15-4-2-3-5-18(15)34-21(22,23)24/h2-5,12,14,16H,6-11H2,1H3,(H,28,31)(H2,25,26,27,29) |
| InChIKey | SLGSDVUQQCQHJE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|