C29H29NO5 — CID 2516810
3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one (PubChem CID 2516810) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is 3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one.
| Compound Name | 3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
|---|---|
| PubChem CID | 2516810 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 3-[2-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethoxy]-8,9,10,11-tetrahydro-7H-cyclohepta[c]chromen-6-one |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)COc3ccc4c5c(c(=O)oc4c3)CCCCC5)c2C)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-18-15-26(19(2)30(18)20-9-11-21(33-3)12-10-20)27(31)17-34-22-13-14-24-23-7-5-4-6-8-25(23)29(32)35-28(24)16-22/h9-16H,4-8,17H2,1-3H3 |
| InChIKey | MWCXKBNXFOZAFZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|