C27H41N3O3 — CID 25168145
N-[(1S,2R)-3-[[6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(2-ethylcyclobut-2-en-1-yl)-2-hydroxypropyl]acetamide (PubChem CID 25168145) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is N-[(1S,2R)-3-[[6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(2-ethylcyclobut-2-en-1-yl)-2-hydroxypropyl]acetamide.
| Compound Name | N-[(1S,2R)-3-[[6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(2-ethylcyclobut-2-en-1-yl)-2-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 25168145 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | N-[(1S,2R)-3-[[6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-1-(2-ethylcyclobut-2-en-1-yl)-2-hydroxypropyl]acetamide |
| SMILES | CCC1=CCC1[C@H](NC(C)=O)[C@H](O)CNC1CC2(CCC2)Oc2ncc(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C27H41N3O3/c1-6-19-8-9-20(19)24(30-17(2)31)23(32)16-28-22-14-27(10-7-11-27)33-25-21(22)12-18(15-29-25)13-26(3,4)5/h8,12,15,20,22-24,28,32H,6-7,9-11,13-14,16H2,1-5H3,(H,30,31)/t20?,22?,23-,24+/m1/s1 |
| InChIKey | IXDRZTBJTVHQDK-GXYBFCANSA-N |
| XLogP | 4.23 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|